About 6-methyl-2-(1,3,4-thiadiazol-2-ylsulfanyl)pyrimidine-4-carboximidamide
6-methyl-2-(1,3,4-thiadiazol-2-ylsulfanyl)pyrimidine-4-carboximidamide (PubChem CID 107551769) has the molecular formula C8H8N6S2
and a molecular weight of 252.33 g/mol. Its IUPAC name is 6-methyl-2-(1,3,4-thiadiazol-2-ylsulfanyl)pyrimidine-4-carboximidamide.
Molecular Properties
| Compound Name | 6-methyl-2-(1,3,4-thiadiazol-2-ylsulfanyl)pyrimidine-4-carboximidamide |
| PubChem CID | 107551769 |
| Molecular Formula | C8H8N6S2 |
| Molecular Weight | 252.33 g/mol |
| Exact Mass | 252.03 |
| IUPAC Name | 6-methyl-2-(1,3,4-thiadiazol-2-ylsulfanyl)pyrimidine-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1cc(C)nc(Sc2nncs2)n1 |
| InChI | InChI=1S/C8H8N6S2/c1-4-2-5(6(9)10)13-7(12-4)16-8-14-11-3-15-8/h2-3H,1H3,(H3,9,10) |
| InChIKey | BYKHHPTYUDLVGK-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 101.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.33 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 6-methyl-2-(1,3,4-thiadiazol-2-ylsulfanyl)pyrimidine-4-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-2-(1,3,4-thiadiazol-2-ylsulfanyl)pyrimidine-4-carboximidamide?
The IUPAC name of 6-methyl-2-(1,3,4-thiadiazol-2-ylsulfanyl)pyrimidine-4-carboximidamide (CID 107551769) is 6-methyl-2-(1,3,4-thiadiazol-2-ylsulfanyl)pyrimidine-4-carboximidamide.
What is the SMILES notation for 6-methyl-2-(1,3,4-thiadiazol-2-ylsulfanyl)pyrimidine-4-carboximidamide?
The canonical SMILES for 6-methyl-2-(1,3,4-thiadiazol-2-ylsulfanyl)pyrimidine-4-carboximidamide is [H]/N=C(\N)c1cc(C)nc(Sc2nncs2)n1.
What is the InChIKey of 6-methyl-2-(1,3,4-thiadiazol-2-ylsulfanyl)pyrimidine-4-carboximidamide?
The InChIKey is BYKHHPTYUDLVGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N6S2/c1-4-2-5(6(9)10)13-7(12-4)16-8-14-11-3-15-8/h2-3H,1H3,(H3,9,10).
What are the key properties of 6-methyl-2-(1,3,4-thiadiazol-2-ylsulfanyl)pyrimidine-4-carboximidamide?
6-methyl-2-(1,3,4-thiadiazol-2-ylsulfanyl)pyrimidine-4-carboximidamide has a molecular weight of 252.33 g/mol, XLogP of 1.07, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-2-(1,3,4-thiadiazol-2-ylsulfanyl)pyrimidine-4-carboximidamide is sourced from PubChem (CID 107551769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).