About [1-(benzenesulfonyl)-2,2-difluoroethenyl]benzene
[1-(benzenesulfonyl)-2,2-difluoroethenyl]benzene (PubChem CID 10755183) has the molecular formula C14H10F2O2S
and a molecular weight of 280.30 g/mol. Its IUPAC name is [1-(benzenesulfonyl)-2,2-difluoroethenyl]benzene.
Molecular Properties
| Compound Name | [1-(benzenesulfonyl)-2,2-difluoroethenyl]benzene |
| PubChem CID | 10755183 |
| Molecular Formula | C14H10F2O2S |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | [1-(benzenesulfonyl)-2,2-difluoroethenyl]benzene |
| SMILES | O=S(=O)(C(=C(F)F)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H10F2O2S/c15-14(16)13(11-7-3-1-4-8-11)19(17,18)12-9-5-2-6-10-12/h1-10H |
| InChIKey | RMEOUYLQEYEIAB-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [1-(benzenesulfonyl)-2,2-difluoroethenyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(benzenesulfonyl)-2,2-difluoroethenyl]benzene?
The IUPAC name of [1-(benzenesulfonyl)-2,2-difluoroethenyl]benzene (CID 10755183) is [1-(benzenesulfonyl)-2,2-difluoroethenyl]benzene.
What is the SMILES notation for [1-(benzenesulfonyl)-2,2-difluoroethenyl]benzene?
The canonical SMILES for [1-(benzenesulfonyl)-2,2-difluoroethenyl]benzene is O=S(=O)(C(=C(F)F)c1ccccc1)c1ccccc1.
What is the InChIKey of [1-(benzenesulfonyl)-2,2-difluoroethenyl]benzene?
The InChIKey is RMEOUYLQEYEIAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10F2O2S/c15-14(16)13(11-7-3-1-4-8-11)19(17,18)12-9-5-2-6-10-12/h1-10H.
What are the key properties of [1-(benzenesulfonyl)-2,2-difluoroethenyl]benzene?
[1-(benzenesulfonyl)-2,2-difluoroethenyl]benzene has a molecular weight of 280.30 g/mol, XLogP of 3.73, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(benzenesulfonyl)-2,2-difluoroethenyl]benzene is sourced from PubChem (CID 10755183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).