About [2-(1,3-thiazol-2-ylsulfanyl)pyrimidin-4-yl]methanamine
[2-(1,3-thiazol-2-ylsulfanyl)pyrimidin-4-yl]methanamine (PubChem CID 107552301) has the molecular formula C8H8N4S2
and a molecular weight of 224.31 g/mol. Its IUPAC name is [2-(1,3-thiazol-2-ylsulfanyl)pyrimidin-4-yl]methanamine.
Molecular Properties
| Compound Name | [2-(1,3-thiazol-2-ylsulfanyl)pyrimidin-4-yl]methanamine |
| PubChem CID | 107552301 |
| Molecular Formula | C8H8N4S2 |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.02 |
| IUPAC Name | [2-(1,3-thiazol-2-ylsulfanyl)pyrimidin-4-yl]methanamine |
| SMILES | NCc1ccnc(Sc2nccs2)n1 |
| InChI | InChI=1S/C8H8N4S2/c9-5-6-1-2-10-7(12-6)14-8-11-3-4-13-8/h1-4H,5,9H2 |
| InChIKey | XBCBMPGAJHZVPC-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|
Analyze [2-(1,3-thiazol-2-ylsulfanyl)pyrimidin-4-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1,3-thiazol-2-ylsulfanyl)pyrimidin-4-yl]methanamine?
The IUPAC name of [2-(1,3-thiazol-2-ylsulfanyl)pyrimidin-4-yl]methanamine (CID 107552301) is [2-(1,3-thiazol-2-ylsulfanyl)pyrimidin-4-yl]methanamine.
What is the SMILES notation for [2-(1,3-thiazol-2-ylsulfanyl)pyrimidin-4-yl]methanamine?
The canonical SMILES for [2-(1,3-thiazol-2-ylsulfanyl)pyrimidin-4-yl]methanamine is NCc1ccnc(Sc2nccs2)n1.
What is the InChIKey of [2-(1,3-thiazol-2-ylsulfanyl)pyrimidin-4-yl]methanamine?
The InChIKey is XBCBMPGAJHZVPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N4S2/c9-5-6-1-2-10-7(12-6)14-8-11-3-4-13-8/h1-4H,5,9H2.
What are the key properties of [2-(1,3-thiazol-2-ylsulfanyl)pyrimidin-4-yl]methanamine?
[2-(1,3-thiazol-2-ylsulfanyl)pyrimidin-4-yl]methanamine has a molecular weight of 224.31 g/mol, XLogP of 1.54, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1,3-thiazol-2-ylsulfanyl)pyrimidin-4-yl]methanamine is sourced from PubChem (CID 107552301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).