About 2-(iodomethyl)-6,6-dimethyloxocane
2-(iodomethyl)-6,6-dimethyloxocane (PubChem CID 10755304) has the molecular formula C10H19IO
and a molecular weight of 282.17 g/mol. Its IUPAC name is 2-(iodomethyl)-6,6-dimethyloxocane.
Molecular Properties
| Compound Name | 2-(iodomethyl)-6,6-dimethyloxocane |
| PubChem CID | 10755304 |
| Molecular Formula | C10H19IO |
| Molecular Weight | 282.17 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | 2-(iodomethyl)-6,6-dimethyloxocane |
| SMILES | CC1(C)CCCC(CI)OCC1 |
| InChI | InChI=1S/C10H19IO/c1-10(2)5-3-4-9(8-11)12-7-6-10/h9H,3-8H2,1-2H3 |
| InChIKey | ZKEVEQZMRIWCCV-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.17 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-(iodomethyl)-6,6-dimethyloxocane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(iodomethyl)-6,6-dimethyloxocane?
The IUPAC name of 2-(iodomethyl)-6,6-dimethyloxocane (CID 10755304) is 2-(iodomethyl)-6,6-dimethyloxocane.
What is the SMILES notation for 2-(iodomethyl)-6,6-dimethyloxocane?
The canonical SMILES for 2-(iodomethyl)-6,6-dimethyloxocane is CC1(C)CCCC(CI)OCC1.
What is the InChIKey of 2-(iodomethyl)-6,6-dimethyloxocane?
The InChIKey is ZKEVEQZMRIWCCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19IO/c1-10(2)5-3-4-9(8-11)12-7-6-10/h9H,3-8H2,1-2H3.
What are the key properties of 2-(iodomethyl)-6,6-dimethyloxocane?
2-(iodomethyl)-6,6-dimethyloxocane has a molecular weight of 282.17 g/mol, XLogP of 3.41, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(iodomethyl)-6,6-dimethyloxocane is sourced from PubChem (CID 10755304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).