C14H15N3O3 — CID 107553225
2-[(4-methoxyphenyl)methylamino]-6-methylpyrimidine-4-carboxylic acid (PubChem CID 107553225) has the molecular formula C14H15N3O3 and a molecular weight of 273.29 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)methylamino]-6-methylpyrimidine-4-carboxylic acid.
| Compound Name | 2-[(4-methoxyphenyl)methylamino]-6-methylpyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 107553225 |
| Molecular Formula | C14H15N3O3 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 2-[(4-methoxyphenyl)methylamino]-6-methylpyrimidine-4-carboxylic acid |
| SMILES | COc1ccc(CNc2nc(C)cc(C(=O)O)n2)cc1 |
| InChI | InChI=1S/C14H15N3O3/c1-9-7-12(13(18)19)17-14(16-9)15-8-10-3-5-11(20-2)6-4-10/h3-7H,8H2,1-2H3,(H,18,19)(H,15,16,17) |
| InChIKey | YTIXRDYGYZTFJI-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |