C13H22N4O2 — CID 107553462
2-[[1-(dimethylamino)-4-methylpentan-2-yl]amino]pyrimidine-4-carboxylic acid (PubChem CID 107553462) has the molecular formula C13H22N4O2 and a molecular weight of 266.34 g/mol. Its IUPAC name is 2-[[1-(dimethylamino)-4-methylpentan-2-yl]amino]pyrimidine-4-carboxylic acid.
| Compound Name | 2-[[1-(dimethylamino)-4-methylpentan-2-yl]amino]pyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 107553462 |
| Molecular Formula | C13H22N4O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 2-[[1-(dimethylamino)-4-methylpentan-2-yl]amino]pyrimidine-4-carboxylic acid |
| SMILES | CC(C)CC(CN(C)C)Nc1nccc(C(=O)O)n1 |
| InChI | InChI=1S/C13H22N4O2/c1-9(2)7-10(8-17(3)4)15-13-14-6-5-11(16-13)12(18)19/h5-6,9-10H,7-8H2,1-4H3,(H,18,19)(H,14,15,16) |
| InChIKey | HSUCUKSVXVZMKW-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |