C17H17NO3 — CID 10755410
(3S,4S)-3-[(1S)-1,2-dihydroxyethyl]-1,4-diphenylazetidin-2-one (PubChem CID 10755410) has the molecular formula C17H17NO3 and a molecular weight of 283.33 g/mol. Its IUPAC name is (3S,4S)-3-[(1S)-1,2-dihydroxyethyl]-1,4-diphenylazetidin-2-one.
| Compound Name | (3S,4S)-3-[(1S)-1,2-dihydroxyethyl]-1,4-diphenylazetidin-2-one |
|---|---|
| PubChem CID | 10755410 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | (3S,4S)-3-[(1S)-1,2-dihydroxyethyl]-1,4-diphenylazetidin-2-one |
| SMILES | O=C1[C@H]([C@H](O)CO)[C@@H](c2ccccc2)N1c1ccccc1 |
| InChI | InChI=1S/C17H17NO3/c19-11-14(20)15-16(12-7-3-1-4-8-12)18(17(15)21)13-9-5-2-6-10-13/h1-10,14-16,19-20H,11H2/t14-,15-,16-/m1/s1 |
| InChIKey | GVDOYZKYVFGYKX-BZUAXINKSA-N |
| XLogP | 1.74 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |