About 1-[5-acetyl-3-(4-methylphenyl)-4,6-dihydrocyclopenta[d][1,2]oxazol-5-yl]ethanone
1-[5-acetyl-3-(4-methylphenyl)-4,6-dihydrocyclopenta[d][1,2]oxazol-5-yl]ethanone (PubChem CID 10755413) has the molecular formula C17H17NO3
and a molecular weight of 283.33 g/mol. Its IUPAC name is 1-[5-acetyl-3-(4-methylphenyl)-4,6-dihydrocyclopenta[d][1,2]oxazol-5-yl]ethanone.
Molecular Properties
| Compound Name | 1-[5-acetyl-3-(4-methylphenyl)-4,6-dihydrocyclopenta[d][1,2]oxazol-5-yl]ethanone |
| PubChem CID | 10755413 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 1-[5-acetyl-3-(4-methylphenyl)-4,6-dihydrocyclopenta[d][1,2]oxazol-5-yl]ethanone |
| SMILES | CC(=O)C1(C(C)=O)Cc2onc(-c3ccc(C)cc3)c2C1 |
| InChI | InChI=1S/C17H17NO3/c1-10-4-6-13(7-5-10)16-14-8-17(11(2)19,12(3)20)9-15(14)21-18-16/h4-7H,8-9H2,1-3H3 |
| InChIKey | SSNSIEUEDHTIKG-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 60.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 1-[5-acetyl-3-(4-methylphenyl)-4,6-dihydrocyclopenta[d][1,2]oxazol-5-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-acetyl-3-(4-methylphenyl)-4,6-dihydrocyclopenta[d][1,2]oxazol-5-yl]ethanone?
The IUPAC name of 1-[5-acetyl-3-(4-methylphenyl)-4,6-dihydrocyclopenta[d][1,2]oxazol-5-yl]ethanone (CID 10755413) is 1-[5-acetyl-3-(4-methylphenyl)-4,6-dihydrocyclopenta[d][1,2]oxazol-5-yl]ethanone.
What is the SMILES notation for 1-[5-acetyl-3-(4-methylphenyl)-4,6-dihydrocyclopenta[d][1,2]oxazol-5-yl]ethanone?
The canonical SMILES for 1-[5-acetyl-3-(4-methylphenyl)-4,6-dihydrocyclopenta[d][1,2]oxazol-5-yl]ethanone is CC(=O)C1(C(C)=O)Cc2onc(-c3ccc(C)cc3)c2C1.
What is the InChIKey of 1-[5-acetyl-3-(4-methylphenyl)-4,6-dihydrocyclopenta[d][1,2]oxazol-5-yl]ethanone?
The InChIKey is SSNSIEUEDHTIKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17NO3/c1-10-4-6-13(7-5-10)16-14-8-17(11(2)19,12(3)20)9-15(14)21-18-16/h4-7H,8-9H2,1-3H3.
What are the key properties of 1-[5-acetyl-3-(4-methylphenyl)-4,6-dihydrocyclopenta[d][1,2]oxazol-5-yl]ethanone?
1-[5-acetyl-3-(4-methylphenyl)-4,6-dihydrocyclopenta[d][1,2]oxazol-5-yl]ethanone has a molecular weight of 283.33 g/mol, XLogP of 2.91, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-acetyl-3-(4-methylphenyl)-4,6-dihydrocyclopenta[d][1,2]oxazol-5-yl]ethanone is sourced from PubChem (CID 10755413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).