C10H11N3O2 — CID 107554480
2-(but-3-yn-2-ylamino)-6-methylpyrimidine-4-carboxylic acid (PubChem CID 107554480) has the molecular formula C10H11N3O2 and a molecular weight of 205.22 g/mol. Its IUPAC name is 2-(but-3-yn-2-ylamino)-6-methylpyrimidine-4-carboxylic acid.
| Compound Name | 2-(but-3-yn-2-ylamino)-6-methylpyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 107554480 |
| Molecular Formula | C10H11N3O2 |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 2-(but-3-yn-2-ylamino)-6-methylpyrimidine-4-carboxylic acid |
| SMILES | C#CC(C)Nc1nc(C)cc(C(=O)O)n1 |
| InChI | InChI=1S/C10H11N3O2/c1-4-6(2)11-10-12-7(3)5-8(13-10)9(14)15/h1,5-6H,2-3H3,(H,14,15)(H,11,12,13) |
| InChIKey | PQKOUWOHURRDHR-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|