C15H24O5 — CID 10755483
methyl (1S,3S,3aR,6R,6aR)-3-hydroxy-3-methyl-6-(2-methyl-1,3-dioxolan-2-yl)-2,3a,4,5,6,6a-hexahydro-1H-pentalene-1-carboxylate (PubChem CID 10755483) has the molecular formula C15H24O5 and a molecular weight of 284.35 g/mol. Its IUPAC name is methyl (1S,3S,3aR,6R,6aR)-3-hydroxy-3-methyl-6-(2-methyl-1,3-dioxolan-2-yl)-2,3a,4,5,6,6a-hexahydro-1H-pentalene-1-carboxylate.
| Compound Name | methyl (1S,3S,3aR,6R,6aR)-3-hydroxy-3-methyl-6-(2-methyl-1,3-dioxolan-2-yl)-2,3a,4,5,6,6a-hexahydro-1H-pentalene-1-carboxylate |
|---|---|
| PubChem CID | 10755483 |
| Molecular Formula | C15H24O5 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | methyl (1S,3S,3aR,6R,6aR)-3-hydroxy-3-methyl-6-(2-methyl-1,3-dioxolan-2-yl)-2,3a,4,5,6,6a-hexahydro-1H-pentalene-1-carboxylate |
| SMILES | COC(=O)[C@H]1C[C@](C)(O)[C@@H]2CC[C@@H](C3(C)OCCO3)[C@H]12 |
| InChI | InChI=1S/C15H24O5/c1-14(17)8-9(13(16)18-3)12-10(14)4-5-11(12)15(2)19-6-7-20-15/h9-12,17H,4-8H2,1-3H3/t9-,10+,11+,12+,14-/m0/s1 |
| InChIKey | HDLOLKCTNXNPKE-KSFQGOMNSA-N |
| XLogP | 1.34 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |