About 2-methylpropyl (2Z)-2-cyano-2-(3-oxo-1,4-dihydroquinoxalin-2-ylidene)acetate
2-methylpropyl (2Z)-2-cyano-2-(3-oxo-1,4-dihydroquinoxalin-2-ylidene)acetate (PubChem CID 10755545) has the molecular formula C15H15N3O3
and a molecular weight of 285.30 g/mol. Its IUPAC name is 2-methylpropyl (2Z)-2-cyano-2-(3-oxo-1,4-dihydroquinoxalin-2-ylidene)acetate.
Molecular Properties
| Compound Name | 2-methylpropyl (2Z)-2-cyano-2-(3-oxo-1,4-dihydroquinoxalin-2-ylidene)acetate |
| PubChem CID | 10755545 |
| Molecular Formula | C15H15N3O3 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 2-methylpropyl (2Z)-2-cyano-2-(3-oxo-1,4-dihydroquinoxalin-2-ylidene)acetate |
| SMILES | CC(C)COC(=O)/C(C#N)=C1\Nc2ccccc2NC1=O |
| InChI | InChI=1S/C15H15N3O3/c1-9(2)8-21-15(20)10(7-16)13-14(19)18-12-6-4-3-5-11(12)17-13/h3-6,9,17H,8H2,1-2H3,(H,18,19)/b13-10- |
| InChIKey | ZDRMVDHTWMPGNI-RAXLEYEMSA-N |
| XLogP | 2.03 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropyl (2Z)-2-cyano-2-(3-oxo-1,4-dihydroquinoxalin-2-ylidene)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl (2Z)-2-cyano-2-(3-oxo-1,4-dihydroquinoxalin-2-ylidene)acetate?
The IUPAC name of 2-methylpropyl (2Z)-2-cyano-2-(3-oxo-1,4-dihydroquinoxalin-2-ylidene)acetate (CID 10755545) is 2-methylpropyl (2Z)-2-cyano-2-(3-oxo-1,4-dihydroquinoxalin-2-ylidene)acetate.
What is the SMILES notation for 2-methylpropyl (2Z)-2-cyano-2-(3-oxo-1,4-dihydroquinoxalin-2-ylidene)acetate?
The canonical SMILES for 2-methylpropyl (2Z)-2-cyano-2-(3-oxo-1,4-dihydroquinoxalin-2-ylidene)acetate is CC(C)COC(=O)/C(C#N)=C1\Nc2ccccc2NC1=O.
What is the InChIKey of 2-methylpropyl (2Z)-2-cyano-2-(3-oxo-1,4-dihydroquinoxalin-2-ylidene)acetate?
The InChIKey is ZDRMVDHTWMPGNI-RAXLEYEMSA-N. The full InChI is InChI=1S/C15H15N3O3/c1-9(2)8-21-15(20)10(7-16)13-14(19)18-12-6-4-3-5-11(12)17-13/h3-6,9,17H,8H2,1-2H3,(H,18,19)/b13-10-.
What are the key properties of 2-methylpropyl (2Z)-2-cyano-2-(3-oxo-1,4-dihydroquinoxalin-2-ylidene)acetate?
2-methylpropyl (2Z)-2-cyano-2-(3-oxo-1,4-dihydroquinoxalin-2-ylidene)acetate has a molecular weight of 285.30 g/mol, XLogP of 2.03, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl (2Z)-2-cyano-2-(3-oxo-1,4-dihydroquinoxalin-2-ylidene)acetate is sourced from PubChem (CID 10755545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).