C13H24N2S — CID 107555623
N-[[5-[[methyl(propan-2-yl)amino]methyl]thiophen-2-yl]methyl]propan-2-amine (PubChem CID 107555623) has the molecular formula C13H24N2S and a molecular weight of 240.42 g/mol. Its IUPAC name is N-[[5-[[methyl(propan-2-yl)amino]methyl]thiophen-2-yl]methyl]propan-2-amine.
| Compound Name | N-[[5-[[methyl(propan-2-yl)amino]methyl]thiophen-2-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 107555623 |
| Molecular Formula | C13H24N2S |
| Molecular Weight | 240.42 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | N-[[5-[[methyl(propan-2-yl)amino]methyl]thiophen-2-yl]methyl]propan-2-amine |
| SMILES | CC(C)NCc1ccc(CN(C)C(C)C)s1 |
| InChI | InChI=1S/C13H24N2S/c1-10(2)14-8-12-6-7-13(16-12)9-15(5)11(3)4/h6-7,10-11,14H,8-9H2,1-5H3 |
| InChIKey | FKBXCDYRZQFRPH-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.42 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |