C14H24N2S — CID 107555665
N-[[5-(piperidin-1-ylmethyl)thiophen-2-yl]methyl]propan-1-amine (PubChem CID 107555665) has the molecular formula C14H24N2S and a molecular weight of 252.43 g/mol. Its IUPAC name is N-[[5-(piperidin-1-ylmethyl)thiophen-2-yl]methyl]propan-1-amine.
| Compound Name | N-[[5-(piperidin-1-ylmethyl)thiophen-2-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 107555665 |
| Molecular Formula | C14H24N2S |
| Molecular Weight | 252.43 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | N-[[5-(piperidin-1-ylmethyl)thiophen-2-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1ccc(CN2CCCCC2)s1 |
| InChI | InChI=1S/C14H24N2S/c1-2-8-15-11-13-6-7-14(17-13)12-16-9-4-3-5-10-16/h6-7,15H,2-5,8-12H2,1H3 |
| InChIKey | UTFYWUMWCYCECP-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.43 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|