C13H18O7 — CID 10755607
methyl (E)-4-[[(3aR,5S,6S,6aR)-5-formyl-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy]but-2-enoate (PubChem CID 10755607) has the molecular formula C13H18O7 and a molecular weight of 286.28 g/mol. Its IUPAC name is methyl (E)-4-[[(3aR,5S,6S,6aR)-5-formyl-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy]but-2-enoate.
| Compound Name | methyl (E)-4-[[(3aR,5S,6S,6aR)-5-formyl-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy]but-2-enoate |
|---|---|
| PubChem CID | 10755607 |
| Molecular Formula | C13H18O7 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | methyl (E)-4-[[(3aR,5S,6S,6aR)-5-formyl-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy]but-2-enoate |
| SMILES | COC(=O)/C=C/CO[C@@H]1[C@H]2OC(C)(C)O[C@H]2O[C@@H]1C=O |
| InChI | InChI=1S/C13H18O7/c1-13(2)19-11-10(8(7-14)18-12(11)20-13)17-6-4-5-9(15)16-3/h4-5,7-8,10-12H,6H2,1-3H3/b5-4+/t8-,10+,11-,12-/m1/s1 |
| InChIKey | PEDSJCUATYEAAZ-QBWCJWQGSA-N |
| XLogP | 0.18 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|