C15H16F3NOS — CID 107557974
N-[[5-[[4-(trifluoromethyl)phenoxy]methyl]thiophen-2-yl]methyl]ethanamine (PubChem CID 107557974) has the molecular formula C15H16F3NOS and a molecular weight of 315.36 g/mol. Its IUPAC name is N-[[5-[[4-(trifluoromethyl)phenoxy]methyl]thiophen-2-yl]methyl]ethanamine.
| Compound Name | N-[[5-[[4-(trifluoromethyl)phenoxy]methyl]thiophen-2-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 107557974 |
| Molecular Formula | C15H16F3NOS |
| Molecular Weight | 315.36 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | N-[[5-[[4-(trifluoromethyl)phenoxy]methyl]thiophen-2-yl]methyl]ethanamine |
| SMILES | CCNCc1ccc(COc2ccc(C(F)(F)F)cc2)s1 |
| InChI | InChI=1S/C15H16F3NOS/c1-2-19-9-13-7-8-14(21-13)10-20-12-5-3-11(4-6-12)15(16,17)18/h3-8,19H,2,9-10H2,1H3 |
| InChIKey | BWDCJJDOZJYDCQ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.36 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |