C13H23NOS — CID 107558021
N-methyl-1-[5-(4-methylpentan-2-yloxymethyl)thiophen-2-yl]methanamine (PubChem CID 107558021) has the molecular formula C13H23NOS and a molecular weight of 241.40 g/mol. Its IUPAC name is N-methyl-1-[5-(4-methylpentan-2-yloxymethyl)thiophen-2-yl]methanamine.
| Compound Name | N-methyl-1-[5-(4-methylpentan-2-yloxymethyl)thiophen-2-yl]methanamine |
|---|---|
| PubChem CID | 107558021 |
| Molecular Formula | C13H23NOS |
| Molecular Weight | 241.40 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | N-methyl-1-[5-(4-methylpentan-2-yloxymethyl)thiophen-2-yl]methanamine |
| SMILES | CNCc1ccc(COC(C)CC(C)C)s1 |
| InChI | InChI=1S/C13H23NOS/c1-10(2)7-11(3)15-9-13-6-5-12(16-13)8-14-4/h5-6,10-11,14H,7-9H2,1-4H3 |
| InChIKey | DYXCQMRWVVTLHX-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.40 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |