C17H29NOS — CID 107558833
N-[[5-(cyclohexylmethoxymethyl)thiophen-2-yl]methyl]-2-methylpropan-1-amine (PubChem CID 107558833) has the molecular formula C17H29NOS and a molecular weight of 295.49 g/mol. Its IUPAC name is N-[[5-(cyclohexylmethoxymethyl)thiophen-2-yl]methyl]-2-methylpropan-1-amine.
| Compound Name | N-[[5-(cyclohexylmethoxymethyl)thiophen-2-yl]methyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 107558833 |
| Molecular Formula | C17H29NOS |
| Molecular Weight | 295.49 g/mol |
| Exact Mass | 295.20 |
| IUPAC Name | N-[[5-(cyclohexylmethoxymethyl)thiophen-2-yl]methyl]-2-methylpropan-1-amine |
| SMILES | CC(C)CNCc1ccc(COCC2CCCCC2)s1 |
| InChI | InChI=1S/C17H29NOS/c1-14(2)10-18-11-16-8-9-17(20-16)13-19-12-15-6-4-3-5-7-15/h8-9,14-15,18H,3-7,10-13H2,1-2H3 |
| InChIKey | XXIAZOHETWNAHO-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.49 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |