C10H9ClF5NO — CID 10755889
4-chloro-3-(2,2,3,3,3-pentafluoropropoxymethyl)aniline (PubChem CID 10755889) has the molecular formula C10H9ClF5NO and a molecular weight of 289.63 g/mol. Its IUPAC name is 4-chloro-3-(2,2,3,3,3-pentafluoropropoxymethyl)aniline.
| Compound Name | 4-chloro-3-(2,2,3,3,3-pentafluoropropoxymethyl)aniline |
|---|---|
| PubChem CID | 10755889 |
| Molecular Formula | C10H9ClF5NO |
| Molecular Weight | 289.63 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | 4-chloro-3-(2,2,3,3,3-pentafluoropropoxymethyl)aniline |
| SMILES | Nc1ccc(Cl)c(COCC(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C10H9ClF5NO/c11-8-2-1-7(17)3-6(8)4-18-5-9(12,13)10(14,15)16/h1-3H,4-5,17H2 |
| InChIKey | HMWRAFFKXHDDJH-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.63 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|