C16H20BrNO2S — CID 107559265
N-[[5-[(2-bromo-4-methoxyphenoxy)methyl]thiophen-2-yl]methyl]propan-2-amine (PubChem CID 107559265) has the molecular formula C16H20BrNO2S and a molecular weight of 370.31 g/mol. Its IUPAC name is N-[[5-[(2-bromo-4-methoxyphenoxy)methyl]thiophen-2-yl]methyl]propan-2-amine.
| Compound Name | N-[[5-[(2-bromo-4-methoxyphenoxy)methyl]thiophen-2-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 107559265 |
| Molecular Formula | C16H20BrNO2S |
| Molecular Weight | 370.31 g/mol |
| Exact Mass | 369.04 |
| IUPAC Name | N-[[5-[(2-bromo-4-methoxyphenoxy)methyl]thiophen-2-yl]methyl]propan-2-amine |
| SMILES | COc1ccc(OCc2ccc(CNC(C)C)s2)c(Br)c1 |
| InChI | InChI=1S/C16H20BrNO2S/c1-11(2)18-9-13-5-6-14(21-13)10-20-16-7-4-12(19-3)8-15(16)17/h4-8,11,18H,9-10H2,1-3H3 |
| InChIKey | ONSANDPWJFGPPL-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.31 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |