About 3-(3-chloro-4-methylphenyl)-1,1-dioxothiolan-3-ol
3-(3-chloro-4-methylphenyl)-1,1-dioxothiolan-3-ol (PubChem CID 107559494) has the molecular formula C11H13ClO3S
and a molecular weight of 260.74 g/mol. Its IUPAC name is 3-(3-chloro-4-methylphenyl)-1,1-dioxothiolan-3-ol.
Molecular Properties
| Compound Name | 3-(3-chloro-4-methylphenyl)-1,1-dioxothiolan-3-ol |
| PubChem CID | 107559494 |
| Molecular Formula | C11H13ClO3S |
| Molecular Weight | 260.74 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | 3-(3-chloro-4-methylphenyl)-1,1-dioxothiolan-3-ol |
| SMILES | Cc1ccc(C2(O)CCS(=O)(=O)C2)cc1Cl |
| InChI | InChI=1S/C11H13ClO3S/c1-8-2-3-9(6-10(8)12)11(13)4-5-16(14,15)7-11/h2-3,6,13H,4-5,7H2,1H3 |
| InChIKey | SYBXTXCTRRRWIV-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.74 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(3-chloro-4-methylphenyl)-1,1-dioxothiolan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-chloro-4-methylphenyl)-1,1-dioxothiolan-3-ol?
The IUPAC name of 3-(3-chloro-4-methylphenyl)-1,1-dioxothiolan-3-ol (CID 107559494) is 3-(3-chloro-4-methylphenyl)-1,1-dioxothiolan-3-ol.
What is the SMILES notation for 3-(3-chloro-4-methylphenyl)-1,1-dioxothiolan-3-ol?
The canonical SMILES for 3-(3-chloro-4-methylphenyl)-1,1-dioxothiolan-3-ol is Cc1ccc(C2(O)CCS(=O)(=O)C2)cc1Cl.
What is the InChIKey of 3-(3-chloro-4-methylphenyl)-1,1-dioxothiolan-3-ol?
The InChIKey is SYBXTXCTRRRWIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13ClO3S/c1-8-2-3-9(6-10(8)12)11(13)4-5-16(14,15)7-11/h2-3,6,13H,4-5,7H2,1H3.
What are the key properties of 3-(3-chloro-4-methylphenyl)-1,1-dioxothiolan-3-ol?
3-(3-chloro-4-methylphenyl)-1,1-dioxothiolan-3-ol has a molecular weight of 260.74 g/mol, XLogP of 1.65, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-chloro-4-methylphenyl)-1,1-dioxothiolan-3-ol is sourced from PubChem (CID 107559494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).