About 4-(3-chloro-4-methylphenyl)-2,6-dimethylheptan-4-ol
4-(3-chloro-4-methylphenyl)-2,6-dimethylheptan-4-ol (PubChem CID 107559705) has the molecular formula C16H25ClO
and a molecular weight of 268.83 g/mol. Its IUPAC name is 4-(3-chloro-4-methylphenyl)-2,6-dimethylheptan-4-ol.
Molecular Properties
| Compound Name | 4-(3-chloro-4-methylphenyl)-2,6-dimethylheptan-4-ol |
| PubChem CID | 107559705 |
| Molecular Formula | C16H25ClO |
| Molecular Weight | 268.83 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 4-(3-chloro-4-methylphenyl)-2,6-dimethylheptan-4-ol |
| SMILES | Cc1ccc(C(O)(CC(C)C)CC(C)C)cc1Cl |
| InChI | InChI=1S/C16H25ClO/c1-11(2)9-16(18,10-12(3)4)14-7-6-13(5)15(17)8-14/h6-8,11-12,18H,9-10H2,1-5H3 |
| InChIKey | NBGLDWHTDDMLJZ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.83 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(3-chloro-4-methylphenyl)-2,6-dimethylheptan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-chloro-4-methylphenyl)-2,6-dimethylheptan-4-ol?
The IUPAC name of 4-(3-chloro-4-methylphenyl)-2,6-dimethylheptan-4-ol (CID 107559705) is 4-(3-chloro-4-methylphenyl)-2,6-dimethylheptan-4-ol.
What is the SMILES notation for 4-(3-chloro-4-methylphenyl)-2,6-dimethylheptan-4-ol?
The canonical SMILES for 4-(3-chloro-4-methylphenyl)-2,6-dimethylheptan-4-ol is Cc1ccc(C(O)(CC(C)C)CC(C)C)cc1Cl.
What is the InChIKey of 4-(3-chloro-4-methylphenyl)-2,6-dimethylheptan-4-ol?
The InChIKey is NBGLDWHTDDMLJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25ClO/c1-11(2)9-16(18,10-12(3)4)14-7-6-13(5)15(17)8-14/h6-8,11-12,18H,9-10H2,1-5H3.
What are the key properties of 4-(3-chloro-4-methylphenyl)-2,6-dimethylheptan-4-ol?
4-(3-chloro-4-methylphenyl)-2,6-dimethylheptan-4-ol has a molecular weight of 268.83 g/mol, XLogP of 4.93, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-chloro-4-methylphenyl)-2,6-dimethylheptan-4-ol is sourced from PubChem (CID 107559705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).