C18H25ClO2 — CID 107561103
4-tert-butyl-2-(3-chloro-4-methylphenyl)cyclohexane-1-carboxylic acid (PubChem CID 107561103) has the molecular formula C18H25ClO2 and a molecular weight of 308.85 g/mol. Its IUPAC name is 4-tert-butyl-2-(3-chloro-4-methylphenyl)cyclohexane-1-carboxylic acid.
| Compound Name | 4-tert-butyl-2-(3-chloro-4-methylphenyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 107561103 |
| Molecular Formula | C18H25ClO2 |
| Molecular Weight | 308.85 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 4-tert-butyl-2-(3-chloro-4-methylphenyl)cyclohexane-1-carboxylic acid |
| SMILES | Cc1ccc(C2CC(C(C)(C)C)CCC2C(=O)O)cc1Cl |
| InChI | InChI=1S/C18H25ClO2/c1-11-5-6-12(9-16(11)19)15-10-13(18(2,3)4)7-8-14(15)17(20)21/h5-6,9,13-15H,7-8,10H2,1-4H3,(H,20,21) |
| InChIKey | OYYNKSVXCOJOGX-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.85 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |