C19H19NO2 — CID 10756139
(1R,2S)-2-(3-methyl-1,2-oxazol-5-yl)-1,3-diphenylpropan-1-ol (PubChem CID 10756139) has the molecular formula C19H19NO2 and a molecular weight of 293.37 g/mol. Its IUPAC name is (1R,2S)-2-(3-methyl-1,2-oxazol-5-yl)-1,3-diphenylpropan-1-ol.
| Compound Name | (1R,2S)-2-(3-methyl-1,2-oxazol-5-yl)-1,3-diphenylpropan-1-ol |
|---|---|
| PubChem CID | 10756139 |
| Molecular Formula | C19H19NO2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | (1R,2S)-2-(3-methyl-1,2-oxazol-5-yl)-1,3-diphenylpropan-1-ol |
| SMILES | Cc1cc([C@@H](Cc2ccccc2)[C@@H](O)c2ccccc2)on1 |
| InChI | InChI=1S/C19H19NO2/c1-14-12-18(22-20-14)17(13-15-8-4-2-5-9-15)19(21)16-10-6-3-7-11-16/h2-12,17,19,21H,13H2,1H3/t17-,19+/m1/s1 |
| InChIKey | SNLHAHMPUHXWPF-MJGOQNOKSA-N |
| XLogP | 4.04 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |