C13H15ClN2O — CID 107562168
(3-chloro-4-methylphenyl)-(2,5-dimethylpyrazol-3-yl)methanol (PubChem CID 107562168) has the molecular formula C13H15ClN2O and a molecular weight of 250.73 g/mol. Its IUPAC name is (3-chloro-4-methylphenyl)-(2,5-dimethylpyrazol-3-yl)methanol.
| Compound Name | (3-chloro-4-methylphenyl)-(2,5-dimethylpyrazol-3-yl)methanol |
|---|---|
| PubChem CID | 107562168 |
| Molecular Formula | C13H15ClN2O |
| Molecular Weight | 250.73 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | (3-chloro-4-methylphenyl)-(2,5-dimethylpyrazol-3-yl)methanol |
| SMILES | Cc1cc(C(O)c2ccc(C)c(Cl)c2)n(C)n1 |
| InChI | InChI=1S/C13H15ClN2O/c1-8-4-5-10(7-11(8)14)13(17)12-6-9(2)15-16(12)3/h4-7,13,17H,1-3H3 |
| InChIKey | FDFLBDRUXDLZIP-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.73 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |