C17H27ClN2O — CID 107562491
[(3-chloro-4-methylphenyl)-(1-methoxy-4,4-dimethylcyclohexyl)methyl]hydrazine (PubChem CID 107562491) has the molecular formula C17H27ClN2O and a molecular weight of 310.87 g/mol. Its IUPAC name is [(3-chloro-4-methylphenyl)-(1-methoxy-4,4-dimethylcyclohexyl)methyl]hydrazine.
| Compound Name | [(3-chloro-4-methylphenyl)-(1-methoxy-4,4-dimethylcyclohexyl)methyl]hydrazine |
|---|---|
| PubChem CID | 107562491 |
| Molecular Formula | C17H27ClN2O |
| Molecular Weight | 310.87 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | [(3-chloro-4-methylphenyl)-(1-methoxy-4,4-dimethylcyclohexyl)methyl]hydrazine |
| SMILES | COC1(C(NN)c2ccc(C)c(Cl)c2)CCC(C)(C)CC1 |
| InChI | InChI=1S/C17H27ClN2O/c1-12-5-6-13(11-14(12)18)15(20-19)17(21-4)9-7-16(2,3)8-10-17/h5-6,11,15,20H,7-10,19H2,1-4H3 |
| InChIKey | UBQGMKYBQOLMIB-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.87 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|