C7HCl2F5N2O — CID 10756259
2-chloro-4-(1,1,2,2,2-pentafluoroethyl)pyrimidine-5-carbonyl chloride (PubChem CID 10756259) has the molecular formula C7HCl2F5N2O and a molecular weight of 294.99 g/mol. Its IUPAC name is 2-chloro-4-(1,1,2,2,2-pentafluoroethyl)pyrimidine-5-carbonyl chloride.
| Compound Name | 2-chloro-4-(1,1,2,2,2-pentafluoroethyl)pyrimidine-5-carbonyl chloride |
|---|---|
| PubChem CID | 10756259 |
| Molecular Formula | C7HCl2F5N2O |
| Molecular Weight | 294.99 g/mol |
| Exact Mass | 293.94 |
| IUPAC Name | 2-chloro-4-(1,1,2,2,2-pentafluoroethyl)pyrimidine-5-carbonyl chloride |
| SMILES | O=C(Cl)c1cnc(Cl)nc1C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7HCl2F5N2O/c8-4(17)2-1-15-5(9)16-3(2)6(10,11)7(12,13)14/h1H |
| InChIKey | NEBHSUOSRXLJSP-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.99 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|