C13H14N2O4S — CID 107564210
(2S)-2-[(5-thiophen-2-yl-1,2-oxazole-3-carbonyl)amino]pentanoic acid (PubChem CID 107564210) has the molecular formula C13H14N2O4S and a molecular weight of 294.33 g/mol. Its IUPAC name is (2S)-2-[(5-thiophen-2-yl-1,2-oxazole-3-carbonyl)amino]pentanoic acid.
| Compound Name | (2S)-2-[(5-thiophen-2-yl-1,2-oxazole-3-carbonyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 107564210 |
| Molecular Formula | C13H14N2O4S |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | (2S)-2-[(5-thiophen-2-yl-1,2-oxazole-3-carbonyl)amino]pentanoic acid |
| SMILES | CCC[C@H](NC(=O)c1cc(-c2cccs2)on1)C(=O)O |
| InChI | InChI=1S/C13H14N2O4S/c1-2-4-8(13(17)18)14-12(16)9-7-10(19-15-9)11-5-3-6-20-11/h3,5-8H,2,4H2,1H3,(H,14,16)(H,17,18)/t8-/m0/s1 |
| InChIKey | WRABIDRZHDACII-QMMMGPOBSA-N |
| XLogP | 2.39 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |