C6HF11O — CID 10756465
2-(1,1,2,2,2-pentafluoroethyl)-2,3-bis(trifluoromethyl)oxirane (PubChem CID 10756465) has the molecular formula C6HF11O and a molecular weight of 298.05 g/mol. Its IUPAC name is 2-(1,1,2,2,2-pentafluoroethyl)-2,3-bis(trifluoromethyl)oxirane.
| Compound Name | 2-(1,1,2,2,2-pentafluoroethyl)-2,3-bis(trifluoromethyl)oxirane |
|---|---|
| PubChem CID | 10756465 |
| Molecular Formula | C6HF11O |
| Molecular Weight | 298.05 g/mol |
| Exact Mass | 297.99 |
| IUPAC Name | 2-(1,1,2,2,2-pentafluoroethyl)-2,3-bis(trifluoromethyl)oxirane |
| SMILES | FC(F)(F)C1OC1(C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6HF11O/c7-3(8,9)1-2(18-1,5(12,13)14)4(10,11)6(15,16)17/h1H |
| InChIKey | PHLKOSGWWLGUOZ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.05 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|