C14H18O7 — CID 10756476
2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),17-diene-16,19-dione (PubChem CID 10756476) has the molecular formula C14H18O7 and a molecular weight of 298.29 g/mol. Its IUPAC name is 2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),17-diene-16,19-dione.
| Compound Name | 2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),17-diene-16,19-dione |
|---|---|
| PubChem CID | 10756476 |
| Molecular Formula | C14H18O7 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),17-diene-16,19-dione |
| SMILES | O=C1C=CC(=O)C2=C1OCCOCCOCCOCCO2 |
| InChI | InChI=1S/C14H18O7/c15-11-1-2-12(16)14-13(11)20-9-7-18-5-3-17-4-6-19-8-10-21-14/h1-2H,3-10H2 |
| InChIKey | UUNFPQPXNFTBGQ-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|