About trimethyl-[2-methyl-4,5-bis(trimethylsilyl)penta-2,3-dienyl]silane
trimethyl-[2-methyl-4,5-bis(trimethylsilyl)penta-2,3-dienyl]silane (PubChem CID 10756533) has the molecular formula C15H34Si3
and a molecular weight of 298.70 g/mol. Its IUPAC name is trimethyl-[2-methyl-4,5-bis(trimethylsilyl)penta-2,3-dienyl]silane.
Molecular Properties
| Compound Name | trimethyl-[2-methyl-4,5-bis(trimethylsilyl)penta-2,3-dienyl]silane |
| PubChem CID | 10756533 |
| Molecular Formula | C15H34Si3 |
| Molecular Weight | 298.70 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | trimethyl-[2-methyl-4,5-bis(trimethylsilyl)penta-2,3-dienyl]silane |
| SMILES | CC(=C=C(C[Si](C)(C)C)[Si](C)(C)C)C[Si](C)(C)C |
| InChI | InChI=1S/C15H34Si3/c1-14(12-16(2,3)4)11-15(18(8,9)10)13-17(5,6)7/h12-13H2,1-10H3 |
| InChIKey | HOXHREPJVVEKBW-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 298.70 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-[2-methyl-4,5-bis(trimethylsilyl)penta-2,3-dienyl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-[2-methyl-4,5-bis(trimethylsilyl)penta-2,3-dienyl]silane?
The IUPAC name of trimethyl-[2-methyl-4,5-bis(trimethylsilyl)penta-2,3-dienyl]silane (CID 10756533) is trimethyl-[2-methyl-4,5-bis(trimethylsilyl)penta-2,3-dienyl]silane.
What is the SMILES notation for trimethyl-[2-methyl-4,5-bis(trimethylsilyl)penta-2,3-dienyl]silane?
The canonical SMILES for trimethyl-[2-methyl-4,5-bis(trimethylsilyl)penta-2,3-dienyl]silane is CC(=C=C(C[Si](C)(C)C)[Si](C)(C)C)C[Si](C)(C)C.
What is the InChIKey of trimethyl-[2-methyl-4,5-bis(trimethylsilyl)penta-2,3-dienyl]silane?
The InChIKey is HOXHREPJVVEKBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H34Si3/c1-14(12-16(2,3)4)11-15(18(8,9)10)13-17(5,6)7/h12-13H2,1-10H3.
What are the key properties of trimethyl-[2-methyl-4,5-bis(trimethylsilyl)penta-2,3-dienyl]silane?
trimethyl-[2-methyl-4,5-bis(trimethylsilyl)penta-2,3-dienyl]silane has a molecular weight of 298.70 g/mol, XLogP of 6.01, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-[2-methyl-4,5-bis(trimethylsilyl)penta-2,3-dienyl]silane is sourced from PubChem (CID 10756533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).