C11H19N3O2 — CID 107565376
(1S)-1-[3-(oxan-3-yl)-1,2,4-oxadiazol-5-yl]butan-1-amine (PubChem CID 107565376) has the molecular formula C11H19N3O2 and a molecular weight of 225.29 g/mol. Its IUPAC name is (1S)-1-[3-(oxan-3-yl)-1,2,4-oxadiazol-5-yl]butan-1-amine.
| Compound Name | (1S)-1-[3-(oxan-3-yl)-1,2,4-oxadiazol-5-yl]butan-1-amine |
|---|---|
| PubChem CID | 107565376 |
| Molecular Formula | C11H19N3O2 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | (1S)-1-[3-(oxan-3-yl)-1,2,4-oxadiazol-5-yl]butan-1-amine |
| SMILES | CCC[C@H](N)c1nc(C2CCCOC2)no1 |
| InChI | InChI=1S/C11H19N3O2/c1-2-4-9(12)11-13-10(14-16-11)8-5-3-6-15-7-8/h8-9H,2-7,12H2,1H3/t8?,9-/m0/s1 |
| InChIKey | GCPCRWBSKCRGHG-GKAPJAKFSA-N |
| XLogP | 1.76 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |