C8H15N3O2 — CID 107565558
2-[5-[(1S)-1-aminobutyl]-1,2,4-oxadiazol-3-yl]ethanol (PubChem CID 107565558) has the molecular formula C8H15N3O2 and a molecular weight of 185.23 g/mol. Its IUPAC name is 2-[5-[(1S)-1-aminobutyl]-1,2,4-oxadiazol-3-yl]ethanol.
| Compound Name | 2-[5-[(1S)-1-aminobutyl]-1,2,4-oxadiazol-3-yl]ethanol |
|---|---|
| PubChem CID | 107565558 |
| Molecular Formula | C8H15N3O2 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 2-[5-[(1S)-1-aminobutyl]-1,2,4-oxadiazol-3-yl]ethanol |
| SMILES | CCC[C@H](N)c1nc(CCO)no1 |
| InChI | InChI=1S/C8H15N3O2/c1-2-3-6(9)8-10-7(4-5-12)11-13-8/h6,12H,2-5,9H2,1H3/t6-/m0/s1 |
| InChIKey | ZWLGCJWNUCTPFM-LURJTMIESA-N |
| XLogP | 0.40 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |