C14H29N3O3 — CID 107565891
(2S)-2-[2-[di(propan-2-yl)amino]ethylcarbamoylamino]pentanoic acid (PubChem CID 107565891) has the molecular formula C14H29N3O3 and a molecular weight of 287.40 g/mol. Its IUPAC name is (2S)-2-[2-[di(propan-2-yl)amino]ethylcarbamoylamino]pentanoic acid.
| Compound Name | (2S)-2-[2-[di(propan-2-yl)amino]ethylcarbamoylamino]pentanoic acid |
|---|---|
| PubChem CID | 107565891 |
| Molecular Formula | C14H29N3O3 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | (2S)-2-[2-[di(propan-2-yl)amino]ethylcarbamoylamino]pentanoic acid |
| SMILES | CCC[C@H](NC(=O)NCCN(C(C)C)C(C)C)C(=O)O |
| InChI | InChI=1S/C14H29N3O3/c1-6-7-12(13(18)19)16-14(20)15-8-9-17(10(2)3)11(4)5/h10-12H,6-9H2,1-5H3,(H,18,19)(H2,15,16,20)/t12-/m0/s1 |
| InChIKey | UCNURGQPASLBFX-LBPRGKRZSA-N |
| XLogP | 1.66 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |