2-[2-(3,5-dimethoxyphenyl)-2-oxoethyl]benzoic acid

C17H16O5 — CID 10756617

IUPAC2-[2-(3,5-dimethoxyphenyl)-2-oxoethyl]benzoic acid
SMILESCOc1cc(OC)cc(C(=O)Cc2ccccc2C(=O)O)c1
InChIInChI=1S/C17H16O5/c1-21-13-7-12(8-14(10-13)22-2)16(18)9-11-5-3-4-6-15(11)17(19)20/h3-8,10H,9H2,1-2H3,(H,19,20)
InChIKeyOBJYWLQGUCLPSN-UHFFFAOYSA-N
MW300.31 g/mol
LogP2.83
Rot. Bonds6

About 2-[2-(3,5-dimethoxyphenyl)-2-oxoethyl]benzoic acid

2-[2-(3,5-dimethoxyphenyl)-2-oxoethyl]benzoic acid (PubChem CID 10756617) has the molecular formula C17H16O5 and a molecular weight of 300.31 g/mol. Its IUPAC name is 2-[2-(3,5-dimethoxyphenyl)-2-oxoethyl]benzoic acid.

Molecular Properties

Compound Name2-[2-(3,5-dimethoxyphenyl)-2-oxoethyl]benzoic acid
PubChem CID10756617
Molecular FormulaC17H16O5
Molecular Weight300.31 g/mol
Exact Mass300.10
IUPAC Name2-[2-(3,5-dimethoxyphenyl)-2-oxoethyl]benzoic acid
SMILESCOc1cc(OC)cc(C(=O)Cc2ccccc2C(=O)O)c1
InChIInChI=1S/C17H16O5/c1-21-13-7-12(8-14(10-13)22-2)16(18)9-11-5-3-4-6-15(11)17(19)20/h3-8,10H,9H2,1-2H3,(H,19,20)
InChIKeyOBJYWLQGUCLPSN-UHFFFAOYSA-N
XLogP2.83
TPSA72.83 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500300.31
LogP ≤ 52.83
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-[2-(3,5-dimethoxyphenyl)-2-oxoethyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-(3,5-dimethoxyphenyl)-2-oxoethyl]benzoic acid?
The IUPAC name of 2-[2-(3,5-dimethoxyphenyl)-2-oxoethyl]benzoic acid (CID 10756617) is 2-[2-(3,5-dimethoxyphenyl)-2-oxoethyl]benzoic acid.
What is the SMILES notation for 2-[2-(3,5-dimethoxyphenyl)-2-oxoethyl]benzoic acid?
The canonical SMILES for 2-[2-(3,5-dimethoxyphenyl)-2-oxoethyl]benzoic acid is COc1cc(OC)cc(C(=O)Cc2ccccc2C(=O)O)c1.
What is the InChIKey of 2-[2-(3,5-dimethoxyphenyl)-2-oxoethyl]benzoic acid?
The InChIKey is OBJYWLQGUCLPSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16O5/c1-21-13-7-12(8-14(10-13)22-2)16(18)9-11-5-3-4-6-15(11)17(19)20/h3-8,10H,9H2,1-2H3,(H,19,20).
What are the key properties of 2-[2-(3,5-dimethoxyphenyl)-2-oxoethyl]benzoic acid?
2-[2-(3,5-dimethoxyphenyl)-2-oxoethyl]benzoic acid has a molecular weight of 300.31 g/mol, XLogP of 2.83, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(3,5-dimethoxyphenyl)-2-oxoethyl]benzoic acid is sourced from PubChem (CID 10756617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).