C22H23N — CID 10756729
1,3-bis(4-methylphenyl)-4,5,6,7-tetrahydro-2H-isoindole (PubChem CID 10756729) has the molecular formula C22H23N and a molecular weight of 301.43 g/mol. Its IUPAC name is 1,3-bis(4-methylphenyl)-4,5,6,7-tetrahydro-2H-isoindole.
| Compound Name | 1,3-bis(4-methylphenyl)-4,5,6,7-tetrahydro-2H-isoindole |
|---|---|
| PubChem CID | 10756729 |
| Molecular Formula | C22H23N |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | 1,3-bis(4-methylphenyl)-4,5,6,7-tetrahydro-2H-isoindole |
| SMILES | Cc1ccc(-c2[nH]c(-c3ccc(C)cc3)c3c2CCCC3)cc1 |
| InChI | InChI=1S/C22H23N/c1-15-7-11-17(12-8-15)21-19-5-3-4-6-20(19)22(23-21)18-13-9-16(2)10-14-18/h7-14,23H,3-6H2,1-2H3 |
| InChIKey | DVVVVMQAOUHTDD-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |