About 2,4-bis(ethylsulfanyl)pyrimido[5,4-c]cinnoline
2,4-bis(ethylsulfanyl)pyrimido[5,4-c]cinnoline (PubChem CID 10756796) has the molecular formula C14H14N4S2
and a molecular weight of 302.43 g/mol. Its IUPAC name is 2,4-bis(ethylsulfanyl)pyrimido[5,4-c]cinnoline.
Molecular Properties
| Compound Name | 2,4-bis(ethylsulfanyl)pyrimido[5,4-c]cinnoline |
| PubChem CID | 10756796 |
| Molecular Formula | C14H14N4S2 |
| Molecular Weight | 302.43 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 2,4-bis(ethylsulfanyl)pyrimido[5,4-c]cinnoline |
| SMILES | CCSc1nc(SCC)c2nnc3ccccc3c2n1 |
| InChI | InChI=1S/C14H14N4S2/c1-3-19-13-12-11(15-14(16-13)20-4-2)9-7-5-6-8-10(9)17-18-12/h5-8H,3-4H2,1-2H3 |
| InChIKey | QWFPFEBUGGZIQC-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.43 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2,4-bis(ethylsulfanyl)pyrimido[5,4-c]cinnoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-bis(ethylsulfanyl)pyrimido[5,4-c]cinnoline?
The IUPAC name of 2,4-bis(ethylsulfanyl)pyrimido[5,4-c]cinnoline (CID 10756796) is 2,4-bis(ethylsulfanyl)pyrimido[5,4-c]cinnoline.
What is the SMILES notation for 2,4-bis(ethylsulfanyl)pyrimido[5,4-c]cinnoline?
The canonical SMILES for 2,4-bis(ethylsulfanyl)pyrimido[5,4-c]cinnoline is CCSc1nc(SCC)c2nnc3ccccc3c2n1.
What is the InChIKey of 2,4-bis(ethylsulfanyl)pyrimido[5,4-c]cinnoline?
The InChIKey is QWFPFEBUGGZIQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N4S2/c1-3-19-13-12-11(15-14(16-13)20-4-2)9-7-5-6-8-10(9)17-18-12/h5-8H,3-4H2,1-2H3.
What are the key properties of 2,4-bis(ethylsulfanyl)pyrimido[5,4-c]cinnoline?
2,4-bis(ethylsulfanyl)pyrimido[5,4-c]cinnoline has a molecular weight of 302.43 g/mol, XLogP of 3.80, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-bis(ethylsulfanyl)pyrimido[5,4-c]cinnoline is sourced from PubChem (CID 10756796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).