C17H32N2O — CID 107568011
(2S)-2-amino-N,N-dicyclohexylpentanamide (PubChem CID 107568011) has the molecular formula C17H32N2O and a molecular weight of 280.46 g/mol. Its IUPAC name is (2S)-2-amino-N,N-dicyclohexylpentanamide.
| Compound Name | (2S)-2-amino-N,N-dicyclohexylpentanamide |
|---|---|
| PubChem CID | 107568011 |
| Molecular Formula | C17H32N2O |
| Molecular Weight | 280.46 g/mol |
| Exact Mass | 280.25 |
| IUPAC Name | (2S)-2-amino-N,N-dicyclohexylpentanamide |
| SMILES | CCC[C@H](N)C(=O)N(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C17H32N2O/c1-2-9-16(18)17(20)19(14-10-5-3-6-11-14)15-12-7-4-8-13-15/h14-16H,2-13,18H2,1H3/t16-/m0/s1 |
| InChIKey | VJWACBBAECHROS-INIZCTEOSA-N |
| XLogP | 3.61 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.46 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |