C18H25NO3 — CID 10756835
(1R,5R,7S,8R)-10-benzyl-3,3,7-trimethyl-2,4-dioxa-10-azatricyclo[6.3.0.01,5]undecan-7-ol (PubChem CID 10756835) has the molecular formula C18H25NO3 and a molecular weight of 303.40 g/mol. Its IUPAC name is (1R,5R,7S,8R)-10-benzyl-3,3,7-trimethyl-2,4-dioxa-10-azatricyclo[6.3.0.01,5]undecan-7-ol.
| Compound Name | (1R,5R,7S,8R)-10-benzyl-3,3,7-trimethyl-2,4-dioxa-10-azatricyclo[6.3.0.01,5]undecan-7-ol |
|---|---|
| PubChem CID | 10756835 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | (1R,5R,7S,8R)-10-benzyl-3,3,7-trimethyl-2,4-dioxa-10-azatricyclo[6.3.0.01,5]undecan-7-ol |
| SMILES | CC1(C)O[C@@H]2C[C@](C)(O)[C@H]3CN(Cc4ccccc4)C[C@@]23O1 |
| InChI | InChI=1S/C18H25NO3/c1-16(2)21-15-9-17(3,20)14-11-19(12-18(14,15)22-16)10-13-7-5-4-6-8-13/h4-8,14-15,20H,9-12H2,1-3H3/t14-,15-,17+,18+/m1/s1 |
| InChIKey | HALKBPKWOQKUJZ-LMSBXDPUSA-N |
| XLogP | 2.16 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |