About 4-(6,7-dimethoxy-1-oxoisoquinolin-2-yl)-N-methylbutanamide
4-(6,7-dimethoxy-1-oxoisoquinolin-2-yl)-N-methylbutanamide (PubChem CID 10756895) has the molecular formula C16H20N2O4
and a molecular weight of 304.35 g/mol. Its IUPAC name is 4-(6,7-dimethoxy-1-oxoisoquinolin-2-yl)-N-methylbutanamide.
Molecular Properties
| Compound Name | 4-(6,7-dimethoxy-1-oxoisoquinolin-2-yl)-N-methylbutanamide |
| PubChem CID | 10756895 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 4-(6,7-dimethoxy-1-oxoisoquinolin-2-yl)-N-methylbutanamide |
| SMILES | CNC(=O)CCCn1ccc2cc(OC)c(OC)cc2c1=O |
| InChI | InChI=1S/C16H20N2O4/c1-17-15(19)5-4-7-18-8-6-11-9-13(21-2)14(22-3)10-12(11)16(18)20/h6,8-10H,4-5,7H2,1-3H3,(H,17,19) |
| InChIKey | FWEHNFIOGJMNFF-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(6,7-dimethoxy-1-oxoisoquinolin-2-yl)-N-methylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(6,7-dimethoxy-1-oxoisoquinolin-2-yl)-N-methylbutanamide?
The IUPAC name of 4-(6,7-dimethoxy-1-oxoisoquinolin-2-yl)-N-methylbutanamide (CID 10756895) is 4-(6,7-dimethoxy-1-oxoisoquinolin-2-yl)-N-methylbutanamide.
What is the SMILES notation for 4-(6,7-dimethoxy-1-oxoisoquinolin-2-yl)-N-methylbutanamide?
The canonical SMILES for 4-(6,7-dimethoxy-1-oxoisoquinolin-2-yl)-N-methylbutanamide is CNC(=O)CCCn1ccc2cc(OC)c(OC)cc2c1=O.
What is the InChIKey of 4-(6,7-dimethoxy-1-oxoisoquinolin-2-yl)-N-methylbutanamide?
The InChIKey is FWEHNFIOGJMNFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2O4/c1-17-15(19)5-4-7-18-8-6-11-9-13(21-2)14(22-3)10-12(11)16(18)20/h6,8-10H,4-5,7H2,1-3H3,(H,17,19).
What are the key properties of 4-(6,7-dimethoxy-1-oxoisoquinolin-2-yl)-N-methylbutanamide?
4-(6,7-dimethoxy-1-oxoisoquinolin-2-yl)-N-methylbutanamide has a molecular weight of 304.35 g/mol, XLogP of 1.54, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6,7-dimethoxy-1-oxoisoquinolin-2-yl)-N-methylbutanamide is sourced from PubChem (CID 10756895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).