C14H9Cl2N5OS — CID 1075698
1-(3,4-dichlorophenyl)-3-(5-pyridin-4-yl-1,3,4-thiadiazol-2-yl)urea (PubChem CID 1075698) has the molecular formula C14H9Cl2N5OS and a molecular weight of 366.23 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-(5-pyridin-4-yl-1,3,4-thiadiazol-2-yl)urea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-(5-pyridin-4-yl-1,3,4-thiadiazol-2-yl)urea |
|---|---|
| PubChem CID | 1075698 |
| Molecular Formula | C14H9Cl2N5OS |
| Molecular Weight | 366.23 g/mol |
| Exact Mass | 364.99 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-(5-pyridin-4-yl-1,3,4-thiadiazol-2-yl)urea |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)Nc1nnc(-c2ccncc2)s1 |
| InChI | InChI=1S/C14H9Cl2N5OS/c15-10-2-1-9(7-11(10)16)18-13(22)19-14-21-20-12(23-14)8-3-5-17-6-4-8/h1-7H,(H2,18,19,21,22) |
| InChIKey | VENGYPNOQYXRLX-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.23 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |