C9H15N3O3 — CID 107569988
4-[(2S)-2-aminopentanoyl]piperazine-2,6-dione (PubChem CID 107569988) has the molecular formula C9H15N3O3 and a molecular weight of 213.24 g/mol. Its IUPAC name is 4-[(2S)-2-aminopentanoyl]piperazine-2,6-dione.
| Compound Name | 4-[(2S)-2-aminopentanoyl]piperazine-2,6-dione |
|---|---|
| PubChem CID | 107569988 |
| Molecular Formula | C9H15N3O3 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.11 |
| IUPAC Name | 4-[(2S)-2-aminopentanoyl]piperazine-2,6-dione |
| SMILES | CCC[C@H](N)C(=O)N1CC(=O)NC(=O)C1 |
| InChI | InChI=1S/C9H15N3O3/c1-2-3-6(10)9(15)12-4-7(13)11-8(14)5-12/h6H,2-5,10H2,1H3,(H,11,13,14)/t6-/m0/s1 |
| InChIKey | OXICUKUWYZJAOH-LURJTMIESA-N |
| XLogP | -1.40 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|