C12H10N4O6 — CID 10757007
(1S,2S,10R,11R)-8,10-dinitro-4-oxido-5-oxa-6-aza-4-azoniatetracyclo[9.2.2.02,10.03,7]pentadeca-3,6,8,12-tetraene (PubChem CID 10757007) has the molecular formula C12H10N4O6 and a molecular weight of 306.23 g/mol. Its IUPAC name is (1S,2S,10R,11R)-8,10-dinitro-4-oxido-5-oxa-6-aza-4-azoniatetracyclo[9.2.2.02,10.03,7]pentadeca-3,6,8,12-tetraene.
| Compound Name | (1S,2S,10R,11R)-8,10-dinitro-4-oxido-5-oxa-6-aza-4-azoniatetracyclo[9.2.2.02,10.03,7]pentadeca-3,6,8,12-tetraene |
|---|---|
| PubChem CID | 10757007 |
| Molecular Formula | C12H10N4O6 |
| Molecular Weight | 306.23 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | (1S,2S,10R,11R)-8,10-dinitro-4-oxido-5-oxa-6-aza-4-azoniatetracyclo[9.2.2.02,10.03,7]pentadeca-3,6,8,12-tetraene |
| SMILES | O=[N+]([O-])C1=C[C@]2([N+](=O)[O-])[C@H]3C=C[C@H](CC3)[C@@H]2c2c1no[n+]2[O-] |
| InChI | InChI=1S/C12H10N4O6/c17-14(18)8-5-12(16(20)21)7-3-1-6(2-4-7)9(12)11-10(8)13-22-15(11)19/h1,3,5-7,9H,2,4H2/t6-,7+,9-,12+/m1/s1 |
| InChIKey | UBNBVBINZFXNJC-GUKKNSHRSA-N |
| XLogP | 0.63 |
| TPSA | 139.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.23 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|