About 4-amino-N-[3,5-bis(methylamino)phenyl]benzenesulfonamide
4-amino-N-[3,5-bis(methylamino)phenyl]benzenesulfonamide (PubChem CID 10757046) has the molecular formula C14H18N4O2S
and a molecular weight of 306.39 g/mol. Its IUPAC name is 4-amino-N-[3,5-bis(methylamino)phenyl]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-amino-N-[3,5-bis(methylamino)phenyl]benzenesulfonamide |
| PubChem CID | 10757046 |
| Molecular Formula | C14H18N4O2S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 4-amino-N-[3,5-bis(methylamino)phenyl]benzenesulfonamide |
| SMILES | CNc1cc(NC)cc(NS(=O)(=O)c2ccc(N)cc2)c1 |
| InChI | InChI=1S/C14H18N4O2S/c1-16-11-7-12(17-2)9-13(8-11)18-21(19,20)14-5-3-10(15)4-6-14/h3-9,16-18H,15H2,1-2H3 |
| InChIKey | WZUGVUIDNNAJLO-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-N-[3,5-bis(methylamino)phenyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-N-[3,5-bis(methylamino)phenyl]benzenesulfonamide?
The IUPAC name of 4-amino-N-[3,5-bis(methylamino)phenyl]benzenesulfonamide (CID 10757046) is 4-amino-N-[3,5-bis(methylamino)phenyl]benzenesulfonamide.
What is the SMILES notation for 4-amino-N-[3,5-bis(methylamino)phenyl]benzenesulfonamide?
The canonical SMILES for 4-amino-N-[3,5-bis(methylamino)phenyl]benzenesulfonamide is CNc1cc(NC)cc(NS(=O)(=O)c2ccc(N)cc2)c1.
What is the InChIKey of 4-amino-N-[3,5-bis(methylamino)phenyl]benzenesulfonamide?
The InChIKey is WZUGVUIDNNAJLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N4O2S/c1-16-11-7-12(17-2)9-13(8-11)18-21(19,20)14-5-3-10(15)4-6-14/h3-9,16-18H,15H2,1-2H3.
What are the key properties of 4-amino-N-[3,5-bis(methylamino)phenyl]benzenesulfonamide?
4-amino-N-[3,5-bis(methylamino)phenyl]benzenesulfonamide has a molecular weight of 306.39 g/mol, XLogP of 2.15, 5 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N-[3,5-bis(methylamino)phenyl]benzenesulfonamide is sourced from PubChem (CID 10757046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).