C17H25NO4 — CID 10757129
(3aS,4aR,8bR)-3a-[(dimethylamino)methyl]-8b-hydroxy-1,2-dimethoxy-4a,5,6,7-tetrahydro-4H-cyclopenta[a]inden-3-one (PubChem CID 10757129) has the molecular formula C17H25NO4 and a molecular weight of 307.39 g/mol. Its IUPAC name is (3aS,4aR,8bR)-3a-[(dimethylamino)methyl]-8b-hydroxy-1,2-dimethoxy-4a,5,6,7-tetrahydro-4H-cyclopenta[a]inden-3-one.
| Compound Name | (3aS,4aR,8bR)-3a-[(dimethylamino)methyl]-8b-hydroxy-1,2-dimethoxy-4a,5,6,7-tetrahydro-4H-cyclopenta[a]inden-3-one |
|---|---|
| PubChem CID | 10757129 |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | (3aS,4aR,8bR)-3a-[(dimethylamino)methyl]-8b-hydroxy-1,2-dimethoxy-4a,5,6,7-tetrahydro-4H-cyclopenta[a]inden-3-one |
| SMILES | COC1=C(OC)[C@@]2(O)C3=CCCC[C@@H]3C[C@@]2(CN(C)C)C1=O |
| InChI | InChI=1S/C17H25NO4/c1-18(2)10-16-9-11-7-5-6-8-12(11)17(16,20)15(22-4)13(21-3)14(16)19/h8,11,20H,5-7,9-10H2,1-4H3/t11-,16-,17+/m1/s1 |
| InChIKey | UCKCUIDLIHRJKO-LQAWEQHXSA-N |
| XLogP | 1.48 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|