C14H16BrN3 — CID 107571400
2-N-(4-bromo-3,5-dimethylphenyl)-3-methylpyridine-2,5-diamine (PubChem CID 107571400) has the molecular formula C14H16BrN3 and a molecular weight of 306.21 g/mol. Its IUPAC name is 2-N-(4-bromo-3,5-dimethylphenyl)-3-methylpyridine-2,5-diamine.
| Compound Name | 2-N-(4-bromo-3,5-dimethylphenyl)-3-methylpyridine-2,5-diamine |
|---|---|
| PubChem CID | 107571400 |
| Molecular Formula | C14H16BrN3 |
| Molecular Weight | 306.21 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 2-N-(4-bromo-3,5-dimethylphenyl)-3-methylpyridine-2,5-diamine |
| SMILES | Cc1cc(N)cnc1Nc1cc(C)c(Br)c(C)c1 |
| InChI | InChI=1S/C14H16BrN3/c1-8-5-12(6-9(2)13(8)15)18-14-10(3)4-11(16)7-17-14/h4-7H,16H2,1-3H3,(H,17,18) |
| InChIKey | UKPJSXAUQPVMCC-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.21 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |