C15H15Cl2FN2O — CID 107571590
3-N-(3,5-dichloro-4-fluorophenyl)-5-propoxybenzene-1,3-diamine (PubChem CID 107571590) has the molecular formula C15H15Cl2FN2O and a molecular weight of 329.20 g/mol. Its IUPAC name is 3-N-(3,5-dichloro-4-fluorophenyl)-5-propoxybenzene-1,3-diamine.
| Compound Name | 3-N-(3,5-dichloro-4-fluorophenyl)-5-propoxybenzene-1,3-diamine |
|---|---|
| PubChem CID | 107571590 |
| Molecular Formula | C15H15Cl2FN2O |
| Molecular Weight | 329.20 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | 3-N-(3,5-dichloro-4-fluorophenyl)-5-propoxybenzene-1,3-diamine |
| SMILES | CCCOc1cc(N)cc(Nc2cc(Cl)c(F)c(Cl)c2)c1 |
| InChI | InChI=1S/C15H15Cl2FN2O/c1-2-3-21-12-5-9(19)4-10(6-12)20-11-7-13(16)15(18)14(17)8-11/h4-8,20H,2-3,19H2,1H3 |
| InChIKey | XABSBUOZZYEAQY-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.20 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|