About 3-fluoro-7-propan-2-yloxyphenoxathiine 10,10-dioxide
3-fluoro-7-propan-2-yloxyphenoxathiine 10,10-dioxide (PubChem CID 10757175) has the molecular formula C15H13FO4S
and a molecular weight of 308.33 g/mol. Its IUPAC name is 3-fluoro-7-propan-2-yloxyphenoxathiine 10,10-dioxide.
Molecular Properties
| Compound Name | 3-fluoro-7-propan-2-yloxyphenoxathiine 10,10-dioxide |
| PubChem CID | 10757175 |
| Molecular Formula | C15H13FO4S |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 3-fluoro-7-propan-2-yloxyphenoxathiine 10,10-dioxide |
| SMILES | CC(C)Oc1ccc2c(c1)Oc1cc(F)ccc1S2(=O)=O |
| InChI | InChI=1S/C15H13FO4S/c1-9(2)19-11-4-6-15-13(8-11)20-12-7-10(16)3-5-14(12)21(15,17)18/h3-9H,1-2H3 |
| InChIKey | VWNFNHGZAYXFPL-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-fluoro-7-propan-2-yloxyphenoxathiine 10,10-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-7-propan-2-yloxyphenoxathiine 10,10-dioxide?
The IUPAC name of 3-fluoro-7-propan-2-yloxyphenoxathiine 10,10-dioxide (CID 10757175) is 3-fluoro-7-propan-2-yloxyphenoxathiine 10,10-dioxide.
What is the SMILES notation for 3-fluoro-7-propan-2-yloxyphenoxathiine 10,10-dioxide?
The canonical SMILES for 3-fluoro-7-propan-2-yloxyphenoxathiine 10,10-dioxide is CC(C)Oc1ccc2c(c1)Oc1cc(F)ccc1S2(=O)=O.
What is the InChIKey of 3-fluoro-7-propan-2-yloxyphenoxathiine 10,10-dioxide?
The InChIKey is VWNFNHGZAYXFPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13FO4S/c1-9(2)19-11-4-6-15-13(8-11)20-12-7-10(16)3-5-14(12)21(15,17)18/h3-9H,1-2H3.
What are the key properties of 3-fluoro-7-propan-2-yloxyphenoxathiine 10,10-dioxide?
3-fluoro-7-propan-2-yloxyphenoxathiine 10,10-dioxide has a molecular weight of 308.33 g/mol, XLogP of 3.55, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-7-propan-2-yloxyphenoxathiine 10,10-dioxide is sourced from PubChem (CID 10757175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).