C18H27BrN2O2 — CID 107572267
tert-butyl 3-(4-bromo-3,5-dimethylanilino)piperidine-1-carboxylate (PubChem CID 107572267) has the molecular formula C18H27BrN2O2 and a molecular weight of 383.33 g/mol. Its IUPAC name is tert-butyl 3-(4-bromo-3,5-dimethylanilino)piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-(4-bromo-3,5-dimethylanilino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 107572267 |
| Molecular Formula | C18H27BrN2O2 |
| Molecular Weight | 383.33 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | tert-butyl 3-(4-bromo-3,5-dimethylanilino)piperidine-1-carboxylate |
| SMILES | Cc1cc(NC2CCCN(C(=O)OC(C)(C)C)C2)cc(C)c1Br |
| InChI | InChI=1S/C18H27BrN2O2/c1-12-9-15(10-13(2)16(12)19)20-14-7-6-8-21(11-14)17(22)23-18(3,4)5/h9-10,14,20H,6-8,11H2,1-5H3 |
| InChIKey | UEHYTCMSGIHXCI-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.33 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |