C13H15Cl2FN2 — CID 107572394
N-(3,5-dichloro-4-fluorophenyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-amine (PubChem CID 107572394) has the molecular formula C13H15Cl2FN2 and a molecular weight of 289.18 g/mol. Its IUPAC name is N-(3,5-dichloro-4-fluorophenyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-amine.
| Compound Name | N-(3,5-dichloro-4-fluorophenyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-amine |
|---|---|
| PubChem CID | 107572394 |
| Molecular Formula | C13H15Cl2FN2 |
| Molecular Weight | 289.18 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | N-(3,5-dichloro-4-fluorophenyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-amine |
| SMILES | Fc1c(Cl)cc(NC2CCN3CCCC23)cc1Cl |
| InChI | InChI=1S/C13H15Cl2FN2/c14-9-6-8(7-10(15)13(9)16)17-11-3-5-18-4-1-2-12(11)18/h6-7,11-12,17H,1-5H2 |
| InChIKey | DNTVVDFRRGYQQX-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.18 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|