C15H12Cl2FN3 — CID 107572808
3,5-dichloro-4-fluoro-N-[(1-methylbenzimidazol-2-yl)methyl]aniline (PubChem CID 107572808) has the molecular formula C15H12Cl2FN3 and a molecular weight of 324.19 g/mol. Its IUPAC name is 3,5-dichloro-4-fluoro-N-[(1-methylbenzimidazol-2-yl)methyl]aniline.
| Compound Name | 3,5-dichloro-4-fluoro-N-[(1-methylbenzimidazol-2-yl)methyl]aniline |
|---|---|
| PubChem CID | 107572808 |
| Molecular Formula | C15H12Cl2FN3 |
| Molecular Weight | 324.19 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | 3,5-dichloro-4-fluoro-N-[(1-methylbenzimidazol-2-yl)methyl]aniline |
| SMILES | Cn1c(CNc2cc(Cl)c(F)c(Cl)c2)nc2ccccc21 |
| InChI | InChI=1S/C15H12Cl2FN3/c1-21-13-5-3-2-4-12(13)20-14(21)8-19-9-6-10(16)15(18)11(17)7-9/h2-7,19H,8H2,1H3 |
| InChIKey | GQKMJNKCWADCQQ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.19 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|